C21H20B3N7O5 — CID 174037066
CID 174037066 (PubChem CID 174037066) has the molecular formula C21H20B3N7O5 and a molecular weight of 482.87 g/mol.
| Compound Name | CID 174037066 |
|---|---|
| PubChem CID | 174037066 |
| Molecular Formula | C21H20B3N7O5 |
| Molecular Weight | 482.87 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2nc(CCO)no2)c1OC |
| InChI | InChI=1S/C21H20B3N7O5/c1-35-17-11(20-27-14(7-8-32)31-36-20)3-2-4-12(17)25-13-9-15(26-18(33)10-5-6-10)29-30-16(13)19(34)28-21(22,23)24/h2-4,9-10,32H,5-8H2,1H3,(H,28,34)(H2,25,26,29,33) |
| InChIKey | BTEAOTXAYCMGAR-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.87 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|