C31H39B3N8O7 — CID 174037062
CID 174037062 (PubChem CID 174037062) has the molecular formula C31H39B3N8O7 and a molecular weight of 668.14 g/mol.
| Compound Name | CID 174037062 |
|---|---|
| PubChem CID | 174037062 |
| Molecular Formula | C31H39B3N8O7 |
| Molecular Weight | 668.14 g/mol |
| Exact Mass | 668.32 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2nc([C@H](NC(=O)OC(C)(C)C)[C@H](C)OC(C)(C)C)no2)c1OC |
| InChI | InChI=1S/C31H39B3N8O7/c1-15(47-29(2,3)4)21(37-28(45)48-30(5,6)7)24-38-27(49-42-24)17-10-9-11-18(23(17)46-8)35-19-14-20(36-25(43)16-12-13-16)40-41-22(19)26(44)39-31(32,33)34/h9-11,14-16,21H,12-13H2,1-8H3,(H,37,45)(H,39,44)(H2,35,36,40,43)/t15-,21+/m0/s1 |
| InChIKey | MZMLOFSTGBIJDT-YCRPNKLZSA-N |
| XLogP | 3.24 |
| TPSA | 191.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.14 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|