C24H26B3N9O5 — CID 174037185
CID 174037185 (PubChem CID 174037185) has the molecular formula C24H26B3N9O5 and a molecular weight of 552.97 g/mol.
| Compound Name | CID 174037185 |
|---|---|
| PubChem CID | 174037185 |
| Molecular Formula | C24H26B3N9O5 |
| Molecular Weight | 552.97 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2nc(CNC(=O)CN(C)C)no2)c1OC |
| InChI | InChI=1S/C24H26B3N9O5/c1-36(2)11-18(37)28-10-17-31-23(41-35-17)13-5-4-6-14(20(13)40-3)29-15-9-16(30-21(38)12-7-8-12)33-34-19(15)22(39)32-24(25,26)27/h4-6,9,12H,7-8,10-11H2,1-3H3,(H,28,37)(H,32,39)(H2,29,30,33,38) |
| InChIKey | UPOOXCNWQCQPHT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 176.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.97 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|