C24H26B3N7O4 — CID 174037207
CID 174037207 (PubChem CID 174037207) has the molecular formula C24H26B3N7O4 and a molecular weight of 508.95 g/mol.
| Compound Name | CID 174037207 |
|---|---|
| PubChem CID | 174037207 |
| Molecular Formula | C24H26B3N7O4 |
| Molecular Weight | 508.95 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2cc(C(C)(C)O)n(C)n2)c1OC |
| InChI | InChI=1S/C24H26B3N7O4/c1-23(2,37)17-10-15(33-34(17)3)13-6-5-7-14(20(13)38-4)28-16-11-18(29-21(35)12-8-9-12)31-32-19(16)22(36)30-24(25,26)27/h5-7,10-12,37H,8-9H2,1-4H3,(H,30,36)(H2,28,29,31,35) |
| InChIKey | CALNAZBSKZNESZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 143.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.95 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|