C29H34B3N9O4 — CID 174037040
CID 174037040 (PubChem CID 174037040) has the molecular formula C29H34B3N9O4 and a molecular weight of 605.09 g/mol.
| Compound Name | CID 174037040 |
|---|---|
| PubChem CID | 174037040 |
| Molecular Formula | C29H34B3N9O4 |
| Molecular Weight | 605.09 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2cc(C(=O)N3CCC(N(C)C)CC3)n(C)n2)c1OC |
| InChI | InChI=1S/C29H34B3N9O4/c1-39(2)17-10-12-41(13-11-17)28(44)22-14-20(38-40(22)3)18-6-5-7-19(25(18)45-4)33-21-15-23(34-26(42)16-8-9-16)36-37-24(21)27(43)35-29(30,31)32/h5-7,14-17H,8-13H2,1-4H3,(H,35,43)(H2,33,34,36,42) |
| InChIKey | CYORFQQQSWGSDC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.09 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|