C27H31B3N8O5 — CID 174037330
CID 174037330 (PubChem CID 174037330) has the molecular formula C27H31B3N8O5 and a molecular weight of 580.03 g/mol.
| Compound Name | CID 174037330 |
|---|---|
| PubChem CID | 174037330 |
| Molecular Formula | C27H31B3N8O5 |
| Molecular Weight | 580.03 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ccn(CCNC(=O)OC(C)(C)C)n2)c1OC |
| InChI | InChI=1S/C27H31B3N8O5/c1-26(2,3)43-25(41)31-11-13-38-12-10-17(37-38)16-6-5-7-18(22(16)42-4)32-19-14-20(33-23(39)15-8-9-15)35-36-21(19)24(40)34-27(28,29)30/h5-7,10,12,14-15H,8-9,11,13H2,1-4H3,(H,31,41)(H,34,40)(H2,32,33,35,39) |
| InChIKey | OPSGNHZSIKDKNN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.03 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|