C25H24B3N7O6S — CID 174036974
CID 174036974 (PubChem CID 174036974) has the molecular formula C25H24B3N7O6S and a molecular weight of 583.01 g/mol.
| Compound Name | CID 174036974 |
|---|---|
| PubChem CID | 174036974 |
| Molecular Formula | C25H24B3N7O6S |
| Molecular Weight | 583.01 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ncc(C(=O)NCCC(=O)OC)s2)c1OC |
| InChI | InChI=1S/C25H24B3N7O6S/c1-40-18(36)8-9-29-22(38)16-11-30-24(42-16)13-4-3-5-14(20(13)41-2)31-15-10-17(32-21(37)12-6-7-12)34-35-19(15)23(39)33-25(26,27)28/h3-5,10-12H,6-9H2,1-2H3,(H,29,38)(H,33,39)(H2,31,32,34,37) |
| InChIKey | SWIXSFLJWRXFDO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 173.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.01 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|