C27H31B3N8O4S — CID 174037303
CID 174037303 (PubChem CID 174037303) has the molecular formula C27H31B3N8O4S and a molecular weight of 596.10 g/mol.
| Compound Name | CID 174037303 |
|---|---|
| PubChem CID | 174037303 |
| Molecular Formula | C27H31B3N8O4S |
| Molecular Weight | 596.10 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2nc(C)c(C(=O)NCCCN(C)C)s2)c1OC |
| InChI | InChI=1S/C27H31B3N8O4S/c1-14-22(25(41)31-11-6-12-38(2)3)43-26(32-14)16-7-5-8-17(21(16)42-4)33-18-13-19(34-23(39)15-9-10-15)36-37-20(18)24(40)35-27(28,29)30/h5,7-8,13,15H,6,9-12H2,1-4H3,(H,31,41)(H,35,40)(H2,33,34,36,39) |
| InChIKey | CLMGNIPOYHBFAS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|