C26H27B3N8O4S — CID 174037304
CID 174037304 (PubChem CID 174037304) has the molecular formula C26H27B3N8O4S and a molecular weight of 580.06 g/mol.
| Compound Name | CID 174037304 |
|---|---|
| PubChem CID | 174037304 |
| Molecular Formula | C26H27B3N8O4S |
| Molecular Weight | 580.06 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2ncc(C(=O)N[C@H](C)CNC=C)s2)c1OC |
| InChI | InChI=1S/C26H27B3N8O4S/c1-4-30-11-13(2)32-23(39)18-12-31-25(42-18)15-6-5-7-16(21(15)41-3)33-17-10-19(34-22(38)14-8-9-14)36-37-20(17)24(40)35-26(27,28)29/h4-7,10,12-14,30H,1,8-9,11H2,2-3H3,(H,32,39)(H,35,40)(H2,33,34,36,38)/t13-/m1/s1 |
| InChIKey | WZBRMIAQBOOCIW-CYBMUJFWSA-N |
| XLogP | 1.40 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.06 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|