C24H26B3N7O3S — CID 174037318
CID 174037318 (PubChem CID 174037318) has the molecular formula C24H26B3N7O3S and a molecular weight of 525.02 g/mol.
| Compound Name | CID 174037318 |
|---|---|
| PubChem CID | 174037318 |
| Molecular Formula | C24H26B3N7O3S |
| Molecular Weight | 525.02 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnccc1Nc1cccc(-c2ncc(C(=O)NCCC3CCCN3C)s2)c1OC |
| InChI | InChI=1S/C24H26B3N7O3S/c1-34-12-4-5-14(34)8-10-28-21(35)18-13-29-23(38-18)15-6-3-7-17(20(15)37-2)31-16-9-11-30-33-19(16)22(36)32-24(25,26)27/h3,6-7,9,11,13-14H,4-5,8,10,12H2,1-2H3,(H,28,35)(H,30,31)(H,32,36) |
| InChIKey | IRUWNNYWWQHBJX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 121.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.02 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|