C27H31B3N10O5 — CID 174036876
CID 174036876 (PubChem CID 174036876) has the molecular formula C27H31B3N10O5 and a molecular weight of 608.05 g/mol.
| Compound Name | CID 174036876 |
|---|---|
| PubChem CID | 174036876 |
| Molecular Formula | C27H31B3N10O5 |
| Molecular Weight | 608.05 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(-c2nc(CNC(=O)CN3CCN(C)CC3)no2)c1OC |
| InChI | InChI=1S/C27H31B3N10O5/c1-39-8-10-40(11-9-39)14-21(41)31-13-20-34-26(45-38-20)16-4-3-5-17(23(16)44-2)32-18-12-19(33-24(42)15-6-7-15)36-37-22(18)25(43)35-27(28,29)30/h3-5,12,15H,6-11,13-14H2,1-2H3,(H,31,41)(H,35,43)(H2,32,33,36,42) |
| InChIKey | XVJCBWAOZJZFDM-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.05 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|