C18H27NO4S — CID 174043705
tert-butyl-[[(3R)-3-(4-hydroxyoxan-4-yl)-3,4-dihydro-2H-chromen-4-yl]amino]-oxidosulfanium (PubChem CID 174043705) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is tert-butyl-[[(3R)-3-(4-hydroxyoxan-4-yl)-3,4-dihydro-2H-chromen-4-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[(3R)-3-(4-hydroxyoxan-4-yl)-3,4-dihydro-2H-chromen-4-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174043705 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | tert-butyl-[[(3R)-3-(4-hydroxyoxan-4-yl)-3,4-dihydro-2H-chromen-4-yl]amino]-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC1c2ccccc2OC[C@@H]1C1(O)CCOCC1 |
| InChI | InChI=1S/C18H27NO4S/c1-17(2,3)24(21)19-16-13-6-4-5-7-15(13)23-12-14(16)18(20)8-10-22-11-9-18/h4-7,14,16,19-20H,8-12H2,1-3H3/t14-,16?,24?/m0/s1 |
| InChIKey | NVGBADNYKVZGOK-RSOQWMNZSA-N |
| XLogP | 2.33 |
| TPSA | 73.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|