C24H26FN7O2 — CID 174045690
(11S)-6-fluoro-22-imino-11,16-dimethyl-15-methylidene-21-phenyl-10-oxa-2,8,13,17,18,20-hexazatricyclo[16.2.2.04,9]docosa-1(21),4(9),5,7,16-pentaen-14-one (PubChem CID 174045690) has the molecular formula C24H26FN7O2 and a molecular weight of 463.52 g/mol. Its IUPAC name is (11S)-6-fluoro-22-imino-11,16-dimethyl-15-methylidene-21-phenyl-10-oxa-2,8,13,17,18,20-hexazatricyclo[16.2.2.04,9]docosa-1(21),4(9),5,7,16-pentaen-14-one.
| Compound Name | (11S)-6-fluoro-22-imino-11,16-dimethyl-15-methylidene-21-phenyl-10-oxa-2,8,13,17,18,20-hexazatricyclo[16.2.2.04,9]docosa-1(21),4(9),5,7,16-pentaen-14-one |
|---|---|
| PubChem CID | 174045690 |
| Molecular Formula | C24H26FN7O2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | (11S)-6-fluoro-22-imino-11,16-dimethyl-15-methylidene-21-phenyl-10-oxa-2,8,13,17,18,20-hexazatricyclo[16.2.2.04,9]docosa-1(21),4(9),5,7,16-pentaen-14-one |
| SMILES | [H]/N=C1/C(c2ccccc2)=C2NCc3cc(F)cnc3O[C@@H](C)CNC(=O)C(=C)C(C)=NN1CN2 |
| InChI | InChI=1S/C24H26FN7O2/c1-14-10-28-23(33)15(2)16(3)31-32-13-30-22(20(21(32)26)17-7-5-4-6-8-17)27-11-18-9-19(25)12-29-24(18)34-14/h4-9,12,14,26-27,30H,2,10-11,13H2,1,3H3,(H,28,33)/b26-21-,31-16?/t14-/m0/s1 |
| InChIKey | GGQYFQUTROFZOB-SBYSUIDVSA-N |
| XLogP | 2.35 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|