C15H11ClN4O3S — CID 17404591
2-chloro-4-nitro-N-[2-(thiophen-3-ylmethyl)pyrazol-3-yl]benzamide (PubChem CID 17404591) has the molecular formula C15H11ClN4O3S and a molecular weight of 362.80 g/mol. Its IUPAC name is 2-chloro-4-nitro-N-[2-(thiophen-3-ylmethyl)pyrazol-3-yl]benzamide.
| Compound Name | 2-chloro-4-nitro-N-[2-(thiophen-3-ylmethyl)pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 17404591 |
| Molecular Formula | C15H11ClN4O3S |
| Molecular Weight | 362.80 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-chloro-4-nitro-N-[2-(thiophen-3-ylmethyl)pyrazol-3-yl]benzamide |
| SMILES | O=C(Nc1ccnn1Cc1ccsc1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H11ClN4O3S/c16-13-7-11(20(22)23)1-2-12(13)15(21)18-14-3-5-17-19(14)8-10-4-6-24-9-10/h1-7,9H,8H2,(H,18,21) |
| InChIKey | PCJNNJMWUKTWPP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|