C9H12BN2OS — CID 174045937
CID 174045937 (PubChem CID 174045937) has the molecular formula C9H12BN2OS and a molecular weight of 207.09 g/mol.
| Compound Name | CID 174045937 |
|---|---|
| PubChem CID | 174045937 |
| Molecular Formula | C9H12BN2OS |
| Molecular Weight | 207.09 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | — |
| SMILES | N[C@H](CS)C(=O)N[B]c1ccccc1 |
| InChI | InChI=1S/C9H12BN2OS/c11-8(6-14)9(13)12-10-7-4-2-1-3-5-7/h1-5,8,14H,6,11H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | LLFRPORFPUJDLO-MRVPVSSYSA-N |
| XLogP | -0.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.09 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|