C24H31N5O — CID 174046983
2-[1-[6-[2-methanimidoyl-5-[(2R)-spiro[2.2]pentan-2-yl]anilino]pyrimidin-4-yl]-4-methylpyrrolidin-3-yl]propan-2-ol (PubChem CID 174046983) has the molecular formula C24H31N5O and a molecular weight of 405.55 g/mol. Its IUPAC name is 2-[1-[6-[2-methanimidoyl-5-[(2R)-spiro[2.2]pentan-2-yl]anilino]pyrimidin-4-yl]-4-methylpyrrolidin-3-yl]propan-2-ol.
| Compound Name | 2-[1-[6-[2-methanimidoyl-5-[(2R)-spiro[2.2]pentan-2-yl]anilino]pyrimidin-4-yl]-4-methylpyrrolidin-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 174046983 |
| Molecular Formula | C24H31N5O |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 2-[1-[6-[2-methanimidoyl-5-[(2R)-spiro[2.2]pentan-2-yl]anilino]pyrimidin-4-yl]-4-methylpyrrolidin-3-yl]propan-2-ol |
| SMILES | [H]/N=C/c1ccc([C@@H]2CC23CC3)cc1Nc1cc(N2CC(C)C(C(C)(C)O)C2)ncn1 |
| InChI | InChI=1S/C24H31N5O/c1-15-12-29(13-19(15)23(2,3)30)22-9-21(26-14-27-22)28-20-8-16(4-5-17(20)11-25)18-10-24(18)6-7-24/h4-5,8-9,11,14-15,18-19,25,30H,6-7,10,12-13H2,1-3H3,(H,26,27,28)/b25-11+/t15?,18-,19?/m0/s1 |
| InChIKey | IDMHCZUVIMCESS-ZQGMNJLHSA-N |
| XLogP | 4.33 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|