C22H25N5O — CID 142556823
5-[6-(2-methanimidoyl-5-spiro[2.2]pentan-2-ylanilino)pyrimidin-4-yl]-5-azaspiro[2.4]heptan-7-ol (PubChem CID 142556823) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is 5-[6-(2-methanimidoyl-5-spiro[2.2]pentan-2-ylanilino)pyrimidin-4-yl]-5-azaspiro[2.4]heptan-7-ol.
| Compound Name | 5-[6-(2-methanimidoyl-5-spiro[2.2]pentan-2-ylanilino)pyrimidin-4-yl]-5-azaspiro[2.4]heptan-7-ol |
|---|---|
| PubChem CID | 142556823 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 5-[6-(2-methanimidoyl-5-spiro[2.2]pentan-2-ylanilino)pyrimidin-4-yl]-5-azaspiro[2.4]heptan-7-ol |
| SMILES | [H]/N=C\c1ccc(C2CC23CC3)cc1Nc1cc(N2CC(O)C3(CC3)C2)ncn1 |
| InChI | InChI=1S/C22H25N5O/c23-10-15-2-1-14(16-9-21(16)3-4-21)7-17(15)26-19-8-20(25-13-24-19)27-11-18(28)22(12-27)5-6-22/h1-2,7-8,10,13,16,18,23,28H,3-6,9,11-12H2,(H,24,25,26)/b23-10- |
| InChIKey | NKLPPYJFOANHBN-RMORIDSASA-N |
| XLogP | 3.45 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|