C21H22ClN5O — CID 112864713
N-(2-chlorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-amine (PubChem CID 112864713) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is N-(2-chlorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-amine.
| Compound Name | N-(2-chlorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112864713 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(2-chlorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-4-amine |
| SMILES | COc1ccc(N2CCN(c3cc(Nc4ccccc4Cl)ncn3)CC2)cc1 |
| InChI | InChI=1S/C21H22ClN5O/c1-28-17-8-6-16(7-9-17)26-10-12-27(13-11-26)21-14-20(23-15-24-21)25-19-5-3-2-4-18(19)22/h2-9,14-15H,10-13H2,1H3,(H,23,24,25) |
| InChIKey | PQUJQHSUDSGRAW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|