About CID 174047742
CID 174047742 (PubChem CID 174047742) has the molecular formula C46H40Cl2O2SiZr-
and a molecular weight of 815.04 g/mol.
Molecular Properties
| Compound Name | CID 174047742 |
| PubChem CID | 174047742 |
| Molecular Formula | C46H40Cl2O2SiZr- |
| Molecular Weight | 815.04 g/mol |
| Exact Mass | 812.12 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)C=C(c1ccccc1-c1ccc(C)o1)C2[c-]1c(-c2ccc(C)o2)c([Si](C)C)c2c(-c3ccccc3)c3c(cc21)CCC3.Cl[Zr]Cl |
| InChI | InChI=1S/C46H40O2Si.2ClH.Zr/c1-27-18-21-34-32(24-27)26-37(35-15-9-10-16-36(35)39-22-19-28(2)47-39)42(34)43-38-25-31-14-11-17-33(31)41(30-12-7-6-8-13-30)44(38)46(49(4)5)45(43)40-23-20-29(3)48-40;;;/h6-10,12-13,15-16,18-26,42H,11,14,17H2,1-5H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | KVOFURJHWMSIDR-UHFFFAOYSA-L |
| XLogP | 13.18 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 815.04 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 174047742 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174047742?
The IUPAC name of CID 174047742 (CID 174047742) is not available.
What is the SMILES notation for CID 174047742?
The canonical SMILES for CID 174047742 is Cc1ccc2c(c1)C=C(c1ccccc1-c1ccc(C)o1)C2[c-]1c(-c2ccc(C)o2)c([Si](C)C)c2c(-c3ccccc3)c3c(cc21)CCC3.Cl[Zr]Cl.
What is the InChIKey of CID 174047742?
The InChIKey is KVOFURJHWMSIDR-UHFFFAOYSA-L. The full InChI is InChI=1S/C46H40O2Si.2ClH.Zr/c1-27-18-21-34-32(24-27)26-37(35-15-9-10-16-36(35)39-22-19-28(2)47-39)42(34)43-38-25-31-14-11-17-33(31)41(30-12-7-6-8-13-30)44(38)46(49(4)5)45(43)40-23-20-29(3)48-40;;;/h6-10,12-13,15-16,18-26,42H,11,14,17H2,1-5H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of CID 174047742?
CID 174047742 has a molecular weight of 815.04 g/mol, XLogP of 13.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174047742 is sourced from PubChem (CID 174047742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).