About CID 175335643
CID 175335643 (PubChem CID 175335643) has the molecular formula C44H39Cl2O2SiZr
and a molecular weight of 790.01 g/mol.
Molecular Properties
| Compound Name | CID 175335643 |
| PubChem CID | 175335643 |
| Molecular Formula | C44H39Cl2O2SiZr |
| Molecular Weight | 790.01 g/mol |
| Exact Mass | 787.11 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2cccc3c2C=C(c2ccc(C)o2)C3C[SiH]CC2C(c3ccc(C)o3)=Cc3c(-c4ccc(C)cc4)cccc32)cc1.Cl[Zr]Cl |
| InChI | InChI=1S/C44H39O2Si.2ClH.Zr/c1-27-11-17-31(18-12-27)33-7-5-9-35-37(33)23-39(43-21-15-29(3)45-43)41(35)25-47-26-42-36-10-6-8-34(32-19-13-28(2)14-20-32)38(36)24-40(42)44-22-16-30(4)46-44;;;/h5-24,41-42,47H,25-26H2,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | MSWPTIGMPAEOGW-UHFFFAOYSA-L |
| XLogP | 13.07 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 790.01 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175335643 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175335643?
The IUPAC name of CID 175335643 (CID 175335643) is not available.
What is the SMILES notation for CID 175335643?
The canonical SMILES for CID 175335643 is Cc1ccc(-c2cccc3c2C=C(c2ccc(C)o2)C3C[SiH]CC2C(c3ccc(C)o3)=Cc3c(-c4ccc(C)cc4)cccc32)cc1.Cl[Zr]Cl.
What is the InChIKey of CID 175335643?
The InChIKey is MSWPTIGMPAEOGW-UHFFFAOYSA-L. The full InChI is InChI=1S/C44H39O2Si.2ClH.Zr/c1-27-11-17-31(18-12-27)33-7-5-9-35-37(33)23-39(43-21-15-29(3)45-43)41(35)25-47-26-42-36-10-6-8-34(32-19-13-28(2)14-20-32)38(36)24-40(42)44-22-16-30(4)46-44;;;/h5-24,41-42,47H,25-26H2,1-4H3;2*1H;/q;;;+2/p-2.
What are the key properties of CID 175335643?
CID 175335643 has a molecular weight of 790.01 g/mol, XLogP of 13.07, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175335643 is sourced from PubChem (CID 175335643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).