About chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane
chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane (PubChem CID 174048595) has the molecular formula C37H30Cl4P2
and a molecular weight of 678.41 g/mol. Its IUPAC name is chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane.
Molecular Properties
| Compound Name | chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane |
| PubChem CID | 174048595 |
| Molecular Formula | C37H30Cl4P2 |
| Molecular Weight | 678.41 g/mol |
| Exact Mass | 676.06 |
| IUPAC Name | chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane |
| SMILES | ClC(Cl)(P(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1)P(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H30Cl4P2/c38-37(39,42(40,31-19-7-1-8-20-31,32-21-9-2-10-22-32)33-23-11-3-12-24-33)43(41,34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H |
| InChIKey | ZEHGYMUXXUAKBE-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 678.41 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane?
The IUPAC name of chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane (CID 174048595) is chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane.
What is the SMILES notation for chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane?
The canonical SMILES for chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane is ClC(Cl)(P(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1)P(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane?
The InChIKey is ZEHGYMUXXUAKBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H30Cl4P2/c38-37(39,42(40,31-19-7-1-8-20-31,32-21-9-2-10-22-32)33-23-11-3-12-24-33)43(41,34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H.
What are the key properties of chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane?
chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane has a molecular weight of 678.41 g/mol, XLogP of 9.44, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[dichloro-[chloro(triphenyl)-λ5-phosphanyl]methyl]-triphenyl-λ5-phosphane is sourced from PubChem (CID 174048595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).