C26H47ClN2O3Sn — CID 174049183
1-[3-chloro-1-(oxan-2-yl)pyrazol-4-yl]ethanone;tributyl(1-ethoxyethenyl)stannane (PubChem CID 174049183) has the molecular formula C26H47ClN2O3Sn and a molecular weight of 589.84 g/mol. Its IUPAC name is 1-[3-chloro-1-(oxan-2-yl)pyrazol-4-yl]ethanone;tributyl(1-ethoxyethenyl)stannane.
| Compound Name | 1-[3-chloro-1-(oxan-2-yl)pyrazol-4-yl]ethanone;tributyl(1-ethoxyethenyl)stannane |
|---|---|
| PubChem CID | 174049183 |
| Molecular Formula | C26H47ClN2O3Sn |
| Molecular Weight | 589.84 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | 1-[3-chloro-1-(oxan-2-yl)pyrazol-4-yl]ethanone;tributyl(1-ethoxyethenyl)stannane |
| SMILES | C=C(OCC)[Sn](CCCC)(CCCC)CCCC.CC(=O)c1cn(C2CCCCO2)nc1Cl |
| InChI | InChI=1S/C10H13ClN2O2.C4H7O.3C4H9.Sn/c1-7(14)8-6-13(12-10(8)11)9-4-2-3-5-15-9;1-3-5-4-2;3*1-3-4-2;/h6,9H,2-5H2,1H3;1,4H2,2H3;3*1,3-4H2,2H3; |
| InChIKey | BSAHHVZEFPWCFE-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.84 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|