About tert-butylbenzene;dichlorozirconium
tert-butylbenzene;dichlorozirconium (PubChem CID 174050820) has the molecular formula C10H13Cl2Zr-
and a molecular weight of 295.34 g/mol. Its IUPAC name is tert-butylbenzene;dichlorozirconium.
Molecular Properties
| Compound Name | tert-butylbenzene;dichlorozirconium |
| PubChem CID | 174050820 |
| Molecular Formula | C10H13Cl2Zr- |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 292.94 |
| IUPAC Name | tert-butylbenzene;dichlorozirconium |
| SMILES | CC(C)(C)c1cc[c-]cc1.Cl[Zr]Cl |
| InChI | InChI=1S/C10H13.2ClH.Zr/c1-10(2,3)9-7-5-4-6-8-9;;;/h5-8H,1-3H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | CPQAZSDFISPWJK-UHFFFAOYSA-L |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tert-butylbenzene;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;dichlorozirconium?
The IUPAC name of tert-butylbenzene;dichlorozirconium (CID 174050820) is tert-butylbenzene;dichlorozirconium.
What is the SMILES notation for tert-butylbenzene;dichlorozirconium?
The canonical SMILES for tert-butylbenzene;dichlorozirconium is CC(C)(C)c1cc[c-]cc1.Cl[Zr]Cl.
What is the InChIKey of tert-butylbenzene;dichlorozirconium?
The InChIKey is CPQAZSDFISPWJK-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H13.2ClH.Zr/c1-10(2,3)9-7-5-4-6-8-9;;;/h5-8H,1-3H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of tert-butylbenzene;dichlorozirconium?
tert-butylbenzene;dichlorozirconium has a molecular weight of 295.34 g/mol, XLogP of 4.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;dichlorozirconium is sourced from PubChem (CID 174050820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).