About lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid
lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid (PubChem CID 174054799) has the molecular formula C4H5BF3LiO5
and a molecular weight of 207.83 g/mol. Its IUPAC name is lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid.
Molecular Properties
| Compound Name | lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid |
| PubChem CID | 174054799 |
| Molecular Formula | C4H5BF3LiO5 |
| Molecular Weight | 207.83 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid |
| SMILES | CC(F)(C(=O)O)C(=O)O.[Li+].[O-]B(F)F |
| InChI | InChI=1S/C4H5FO4.BF2O.Li/c1-4(5,2(6)7)3(8)9;2-1(3)4;/h1H3,(H,6,7)(H,8,9);;/q;-1;+1 |
| InChIKey | QDTWRYGLKMMHHZ-UHFFFAOYSA-N |
| XLogP | -3.84 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.83 |
| LogP ≤ 5 | -3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid?
The IUPAC name of lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid (CID 174054799) is lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid.
What is the SMILES notation for lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid?
The canonical SMILES for lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid is CC(F)(C(=O)O)C(=O)O.[Li+].[O-]B(F)F.
What is the InChIKey of lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid?
The InChIKey is QDTWRYGLKMMHHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FO4.BF2O.Li/c1-4(5,2(6)7)3(8)9;2-1(3)4;/h1H3,(H,6,7)(H,8,9);;/q;-1;+1.
What are the key properties of lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid?
lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid has a molecular weight of 207.83 g/mol, XLogP of -3.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;difluoroborinate;2-fluoro-2-methylpropanedioic acid is sourced from PubChem (CID 174054799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).