C19H26FN5O3 — CID 174054800
(2S)-4-[2-[2-[amino(cyclopropyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 174054800) has the molecular formula C19H26FN5O3 and a molecular weight of 391.45 g/mol. Its IUPAC name is (2S)-4-[2-[2-[amino(cyclopropyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (2S)-4-[2-[2-[amino(cyclopropyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174054800 |
| Molecular Formula | C19H26FN5O3 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (2S)-4-[2-[2-[amino(cyclopropyl)methylidene]hydrazinyl]-1-(4-fluorophenyl)-2-oxoethyl]-2,5-dimethylpiperazine-1-carboxylic acid |
| SMILES | CC1CN(C(=O)O)[C@@H](C)CN1C(C(=O)NN=C(N)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H26FN5O3/c1-11-10-25(19(27)28)12(2)9-24(11)16(13-5-7-15(20)8-6-13)18(26)23-22-17(21)14-3-4-14/h5-8,11-12,14,16H,3-4,9-10H2,1-2H3,(H2,21,22)(H,23,26)(H,27,28)/t11?,12-,16?/m0/s1 |
| InChIKey | NNYJROPGKXKKQW-BGMSHATGSA-N |
| XLogP | 1.74 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|