C28H30N4O2 — CID 174063916
N-(4-methylphenyl)-N'-nitro-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidine-1-carboximidamide (PubChem CID 174063916) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-(4-methylphenyl)-N'-nitro-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidine-1-carboximidamide.
| Compound Name | N-(4-methylphenyl)-N'-nitro-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 174063916 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | N-(4-methylphenyl)-N'-nitro-3-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyl)piperidine-1-carboximidamide |
| SMILES | Cc1ccc(NC(=N[N+](=O)[O-])N2CCCC(C3c4ccccc4CCc4ccccc43)C2)cc1 |
| InChI | InChI=1S/C28H30N4O2/c1-20-12-16-24(17-13-20)29-28(30-32(33)34)31-18-6-9-23(19-31)27-25-10-4-2-7-21(25)14-15-22-8-3-5-11-26(22)27/h2-5,7-8,10-13,16-17,23,27H,6,9,14-15,18-19H2,1H3,(H,29,30) |
| InChIKey | ZKDDYMGBMIOOSS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|