C34H34N4 — CID 3619037
1-N',2-N'-bis(2,3-dihydro-1H-inden-1-yl)-1-N,2-N-bis(4-methylphenyl)ethanediimidamide (PubChem CID 3619037) has the molecular formula C34H34N4 and a molecular weight of 498.67 g/mol. Its IUPAC name is 1-N',2-N'-bis(2,3-dihydro-1H-inden-1-yl)-1-N,2-N-bis(4-methylphenyl)ethanediimidamide.
| Compound Name | 1-N',2-N'-bis(2,3-dihydro-1H-inden-1-yl)-1-N,2-N-bis(4-methylphenyl)ethanediimidamide |
|---|---|
| PubChem CID | 3619037 |
| Molecular Formula | C34H34N4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 1-N',2-N'-bis(2,3-dihydro-1H-inden-1-yl)-1-N,2-N-bis(4-methylphenyl)ethanediimidamide |
| SMILES | Cc1ccc(NC(=N\C2CCc3ccccc32)/C(=N/C2CCc3ccccc32)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H34N4/c1-23-11-17-27(18-12-23)35-33(37-31-21-15-25-7-3-5-9-29(25)31)34(36-28-19-13-24(2)14-20-28)38-32-22-16-26-8-4-6-10-30(26)32/h3-14,17-20,31-32H,15-16,21-22H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | KPDXNJQSGHYNGS-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|