C11H12B2F3NO2 — CID 174064096
CID 174064096 (PubChem CID 174064096) has the molecular formula C11H12B2F3NO2 and a molecular weight of 268.84 g/mol.
| Compound Name | CID 174064096 |
|---|---|
| PubChem CID | 174064096 |
| Molecular Formula | C11H12B2F3NO2 |
| Molecular Weight | 268.84 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | — |
| SMILES | [B]C1(C)OB(c2ccnc(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C11H12B2F3NO2/c1-9(2)10(3,12)19-13(18-9)7-4-5-17-8(6-7)11(14,15)16/h4-6H,1-3H3 |
| InChIKey | DTXCYJPWAWPYRD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.84 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|