C21H22BN5O4S2 — CID 174065671
CID 174065671 (PubChem CID 174065671) has the molecular formula C21H22BN5O4S2 and a molecular weight of 483.38 g/mol.
| Compound Name | CID 174065671 |
|---|---|
| PubChem CID | 174065671 |
| Molecular Formula | C21H22BN5O4S2 |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2cncc(OCC)n2)ccc1NC(=O)Cc1csc(N(C)S(=O)(=O)C2CC2)n1 |
| InChI | InChI=1S/C21H22BN5O4S2/c1-3-31-20-11-23-10-18(26-20)13-4-7-17(16(22)8-13)25-19(28)9-14-12-32-21(24-14)27(2)33(29,30)15-5-6-15/h4,7-8,10-12,15H,3,5-6,9H2,1-2H3,(H,25,28) |
| InChIKey | ZZYKPOCMHFHANJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|