C13H19BN2 — CID 174065936
CID 174065936 (PubChem CID 174065936) has the molecular formula C13H19BN2 and a molecular weight of 214.12 g/mol.
| Compound Name | CID 174065936 |
|---|---|
| PubChem CID | 174065936 |
| Molecular Formula | C13H19BN2 |
| Molecular Weight | 214.12 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | — |
| SMILES | [B][C@]1(C)CN(Cc2ccccc2)C[C@H](C)N1 |
| InChI | InChI=1S/C13H19BN2/c1-11-8-16(10-13(2,14)15-11)9-12-6-4-3-5-7-12/h3-7,11,15H,8-10H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | KMPYMIKVFCCZBI-AAEUAGOBSA-N |
| XLogP | 1.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.12 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|