C21H22B3N7O2 — CID 174066317
CID 174066317 (PubChem CID 174066317) has the molecular formula C21H22B3N7O2 and a molecular weight of 436.89 g/mol.
| Compound Name | CID 174066317 |
|---|---|
| PubChem CID | 174066317 |
| Molecular Formula | C21H22B3N7O2 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1nc(NC2CCC(C)(O)CC2)nc2[nH]cc(-c3ccc4nnc(C)n4c3)c12 |
| InChI | InChI=1S/C21H22B3N7O2/c1-11-29-30-15-4-3-12(10-31(11)15)14-9-25-17-16(14)18(33-21(22,23)24)28-19(27-17)26-13-5-7-20(2,32)8-6-13/h3-4,9-10,13,32H,5-8H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | MZVGZDWGLMVCMO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|