C21H21B3N6O2 — CID 174066440
CID 174066440 (PubChem CID 174066440) has the molecular formula C21H21B3N6O2 and a molecular weight of 421.88 g/mol.
| Compound Name | CID 174066440 |
|---|---|
| PubChem CID | 174066440 |
| Molecular Formula | C21H21B3N6O2 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1nc(NC2CCC(C)(O)CC2)nc2[nH]cc(-c3ccn4nccc4c3)c12 |
| InChI | InChI=1S/C21H21B3N6O2/c1-20(31)6-2-13(3-7-20)27-19-28-17-16(18(29-19)32-21(22,23)24)15(11-25-17)12-5-9-30-14(10-12)4-8-26-30/h4-5,8-11,13,31H,2-3,6-7H2,1H3,(H2,25,27,28,29) |
| InChIKey | FXOIGQCWUKKSNX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|