C23H24B3N7O3 — CID 174066443
CID 174066443 (PubChem CID 174066443) has the molecular formula C23H24B3N7O3 and a molecular weight of 478.93 g/mol.
| Compound Name | CID 174066443 |
|---|---|
| PubChem CID | 174066443 |
| Molecular Formula | C23H24B3N7O3 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1nc(NC2CCC(C)(O)CC2)nc2[nH]cc(-c3ccn4ncc(C(=O)NC)c4c3)c12 |
| InChI | InChI=1S/C23H24B3N7O3/c1-22(35)6-3-13(4-7-22)30-21-31-18-17(20(32-21)36-23(24,25)26)14(10-28-18)12-5-8-33-16(9-12)15(11-29-33)19(34)27-2/h5,8-11,13,35H,3-4,6-7H2,1-2H3,(H,27,34)(H2,28,30,31,32) |
| InChIKey | UQWXYYXCDDTYRO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|