C20H24ClN3O3 — CID 17406638
2-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 17406638) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is 2-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 17406638 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C(CN1C(=O)CC2(CCCC2)C1=O)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H24ClN3O3/c21-15-5-1-2-6-16(15)22-9-11-23(12-10-22)18(26)14-24-17(25)13-20(19(24)27)7-3-4-8-20/h1-2,5-6H,3-4,7-14H2 |
| InChIKey | YCKPPBSFBGTAFR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|