C21H29ClN4O3 — CID 9082251
3-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-5,5-dipropylimidazolidine-2,4-dione (PubChem CID 9082251) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is 3-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-5,5-dipropylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-5,5-dipropylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9082251 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 3-[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-5,5-dipropylimidazolidine-2,4-dione |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)N2CCN(c3ccccc3Cl)CC2)C1=O |
| InChI | InChI=1S/C21H29ClN4O3/c1-3-9-21(10-4-2)19(28)26(20(29)23-21)15-18(27)25-13-11-24(12-14-25)17-8-6-5-7-16(17)22/h5-8H,3-4,9-15H2,1-2H3,(H,23,29) |
| InChIKey | XJEJAWVUXJTIDY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|