C16H27BClNO3S — CID 174069916
3-chloro-N-ethyl-4-[methyl(2,3,3-trimethylbutan-2-yloxy)boranyl]benzenesulfonamide (PubChem CID 174069916) has the molecular formula C16H27BClNO3S and a molecular weight of 359.73 g/mol. Its IUPAC name is 3-chloro-N-ethyl-4-[methyl(2,3,3-trimethylbutan-2-yloxy)boranyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-ethyl-4-[methyl(2,3,3-trimethylbutan-2-yloxy)boranyl]benzenesulfonamide |
|---|---|
| PubChem CID | 174069916 |
| Molecular Formula | C16H27BClNO3S |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-chloro-N-ethyl-4-[methyl(2,3,3-trimethylbutan-2-yloxy)boranyl]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(B(C)OC(C)(C)C(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C16H27BClNO3S/c1-8-19-23(20,21)12-9-10-13(14(18)11-12)17(7)22-16(5,6)15(2,3)4/h9-11,19H,8H2,1-7H3 |
| InChIKey | IHSKJTDMOPXZRT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|