C8H10BrNO5S2 — CID 175695681
4-bromo-3-(ethylsulfamoyl)benzenesulfonic acid (PubChem CID 175695681) has the molecular formula C8H10BrNO5S2 and a molecular weight of 344.21 g/mol. Its IUPAC name is 4-bromo-3-(ethylsulfamoyl)benzenesulfonic acid.
| Compound Name | 4-bromo-3-(ethylsulfamoyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 175695681 |
| Molecular Formula | C8H10BrNO5S2 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | 4-bromo-3-(ethylsulfamoyl)benzenesulfonic acid |
| SMILES | CCNS(=O)(=O)c1cc(S(=O)(=O)O)ccc1Br |
| InChI | InChI=1S/C8H10BrNO5S2/c1-2-10-16(11,12)8-5-6(17(13,14)15)3-4-7(8)9/h3-5,10H,2H2,1H3,(H,13,14,15) |
| InChIKey | QTHXCINDLSSMJP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|