C10H14BrNO5S2 — CID 155100687
methyl [4-bromo-3-(ethylsulfamoyl)phenyl]methanesulfonate (PubChem CID 155100687) has the molecular formula C10H14BrNO5S2 and a molecular weight of 372.26 g/mol. Its IUPAC name is methyl [4-bromo-3-(ethylsulfamoyl)phenyl]methanesulfonate.
| Compound Name | methyl [4-bromo-3-(ethylsulfamoyl)phenyl]methanesulfonate |
|---|---|
| PubChem CID | 155100687 |
| Molecular Formula | C10H14BrNO5S2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | methyl [4-bromo-3-(ethylsulfamoyl)phenyl]methanesulfonate |
| SMILES | CCNS(=O)(=O)c1cc(CS(=O)(=O)OC)ccc1Br |
| InChI | InChI=1S/C10H14BrNO5S2/c1-3-12-19(15,16)10-6-8(4-5-9(10)11)7-18(13,14)17-2/h4-6,12H,3,7H2,1-2H3 |
| InChIKey | FCRZWGHBBXCFRM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|