C10H14Br2N2O4S2 — CID 12890966
4,5-dibromo-1-N,3-N-diethylbenzene-1,3-disulfonamide (PubChem CID 12890966) has the molecular formula C10H14Br2N2O4S2 and a molecular weight of 450.17 g/mol. Its IUPAC name is 4,5-dibromo-1-N,3-N-diethylbenzene-1,3-disulfonamide.
| Compound Name | 4,5-dibromo-1-N,3-N-diethylbenzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 12890966 |
| Molecular Formula | C10H14Br2N2O4S2 |
| Molecular Weight | 450.17 g/mol |
| Exact Mass | 447.88 |
| IUPAC Name | 4,5-dibromo-1-N,3-N-diethylbenzene-1,3-disulfonamide |
| SMILES | CCNS(=O)(=O)c1cc(Br)c(Br)c(S(=O)(=O)NCC)c1 |
| InChI | InChI=1S/C10H14Br2N2O4S2/c1-3-13-19(15,16)7-5-8(11)10(12)9(6-7)20(17,18)14-4-2/h5-6,13-14H,3-4H2,1-2H3 |
| InChIKey | OLONKZXMHXIZFQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.17 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |