C18H18BNO4 — CID 174070914
1-[2-([1]benzofuro[3,2-b]pyridin-9-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]ethanone (PubChem CID 174070914) has the molecular formula C18H18BNO4 and a molecular weight of 323.16 g/mol. Its IUPAC name is 1-[2-([1]benzofuro[3,2-b]pyridin-9-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]ethanone.
| Compound Name | 1-[2-([1]benzofuro[3,2-b]pyridin-9-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]ethanone |
|---|---|
| PubChem CID | 174070914 |
| Molecular Formula | C18H18BNO4 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[2-([1]benzofuro[3,2-b]pyridin-9-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]ethanone |
| SMILES | CC(=O)C1(C)OB(c2cccc3oc4cccnc4c23)OC1(C)C |
| InChI | InChI=1S/C18H18BNO4/c1-11(21)18(4)17(2,3)23-19(24-18)12-7-5-8-13-15(12)16-14(22-13)9-6-10-20-16/h5-10H,1-4H3 |
| InChIKey | CUJPEFWLLKFJNJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|