C14H28O9S — CID 174070967
5-[(2S)-2,3-dihydroxy-1-[(3R)-3-hydroxy-1-sulfanylbutan-2-yl]oxypropoxy]-6-(hydroxymethyl)-2-methyloxane-3,4-diol (PubChem CID 174070967) has the molecular formula C14H28O9S and a molecular weight of 372.44 g/mol. Its IUPAC name is 5-[(2S)-2,3-dihydroxy-1-[(3R)-3-hydroxy-1-sulfanylbutan-2-yl]oxypropoxy]-6-(hydroxymethyl)-2-methyloxane-3,4-diol.
| Compound Name | 5-[(2S)-2,3-dihydroxy-1-[(3R)-3-hydroxy-1-sulfanylbutan-2-yl]oxypropoxy]-6-(hydroxymethyl)-2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 174070967 |
| Molecular Formula | C14H28O9S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 5-[(2S)-2,3-dihydroxy-1-[(3R)-3-hydroxy-1-sulfanylbutan-2-yl]oxypropoxy]-6-(hydroxymethyl)-2-methyloxane-3,4-diol |
| SMILES | CC1OC(CO)C(OC(OC(CS)[C@@H](C)O)[C@@H](O)CO)C(O)C1O |
| InChI | InChI=1S/C14H28O9S/c1-6(17)10(5-24)22-14(8(18)3-15)23-13-9(4-16)21-7(2)11(19)12(13)20/h6-20,24H,3-5H2,1-2H3/t6-,7?,8+,9?,10?,11?,12?,13?,14?/m1/s1 |
| InChIKey | LBRDCPLIJIYVOA-MOJYTOGKSA-N |
| XLogP | -2.75 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|