C13H26O11 — CID 90347071
(5S,6S)-6-(hydroxymethyl)-5-[(1S,2S)-2-hydroxy-1-[(3R)-1,3,4-trihydroxybutan-2-yl]oxypropoxy]oxane-2,3,4-triol (PubChem CID 90347071) has the molecular formula C13H26O11 and a molecular weight of 358.34 g/mol. Its IUPAC name is (5S,6S)-6-(hydroxymethyl)-5-[(1S,2S)-2-hydroxy-1-[(3R)-1,3,4-trihydroxybutan-2-yl]oxypropoxy]oxane-2,3,4-triol.
| Compound Name | (5S,6S)-6-(hydroxymethyl)-5-[(1S,2S)-2-hydroxy-1-[(3R)-1,3,4-trihydroxybutan-2-yl]oxypropoxy]oxane-2,3,4-triol |
|---|---|
| PubChem CID | 90347071 |
| Molecular Formula | C13H26O11 |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (5S,6S)-6-(hydroxymethyl)-5-[(1S,2S)-2-hydroxy-1-[(3R)-1,3,4-trihydroxybutan-2-yl]oxypropoxy]oxane-2,3,4-triol |
| SMILES | C[C@H](O)[C@@H](OC(CO)[C@H](O)CO)O[C@H]1C(O)C(O)C(O)O[C@H]1CO |
| InChI | InChI=1S/C13H26O11/c1-5(17)13(23-7(3-15)6(18)2-14)24-11-8(4-16)22-12(21)10(20)9(11)19/h5-21H,2-4H2,1H3/t5-,6+,7?,8-,9?,10?,11+,12?,13-/m0/s1 |
| InChIKey | UALGQKWUZNEPRX-KXZHRNMUSA-N |
| XLogP | -4.76 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|