C10H20O8 — CID 89403321
(3R,4R)-4-[(1R,2S)-2-hydroxy-1-(oxiran-2-yloxy)propoxy]pentane-1,2,3,5-tetrol (PubChem CID 89403321) has the molecular formula C10H20O8 and a molecular weight of 268.26 g/mol. Its IUPAC name is (3R,4R)-4-[(1R,2S)-2-hydroxy-1-(oxiran-2-yloxy)propoxy]pentane-1,2,3,5-tetrol.
| Compound Name | (3R,4R)-4-[(1R,2S)-2-hydroxy-1-(oxiran-2-yloxy)propoxy]pentane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 89403321 |
| Molecular Formula | C10H20O8 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3R,4R)-4-[(1R,2S)-2-hydroxy-1-(oxiran-2-yloxy)propoxy]pentane-1,2,3,5-tetrol |
| SMILES | C[C@H](O)[C@@H](OC1CO1)O[C@H](CO)[C@H](O)C(O)CO |
| InChI | InChI=1S/C10H20O8/c1-5(13)10(18-8-4-16-8)17-7(3-12)9(15)6(14)2-11/h5-15H,2-4H2,1H3/t5-,6?,7+,8?,9+,10+/m0/s1 |
| InChIKey | PHWDJKGWOHYIAA-FAHDRRCQSA-N |
| XLogP | -2.84 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|