C7H14O5 — CID 176977365
2-[3-(hydroxymethyl)oxiran-2-yl]oxybutane-1,3-diol (PubChem CID 176977365) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is 2-[3-(hydroxymethyl)oxiran-2-yl]oxybutane-1,3-diol.
| Compound Name | 2-[3-(hydroxymethyl)oxiran-2-yl]oxybutane-1,3-diol |
|---|---|
| PubChem CID | 176977365 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-[3-(hydroxymethyl)oxiran-2-yl]oxybutane-1,3-diol |
| SMILES | CC(O)C(CO)OC1OC1CO |
| InChI | InChI=1S/C7H14O5/c1-4(10)5(2-8)11-7-6(3-9)12-7/h4-10H,2-3H2,1H3 |
| InChIKey | PDGJWBFMDLOYED-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|