C12H24O9 — CID 71096886
(2R,3R,4R,5R)-7-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]heptane-1,2,3,4,5-pentol (PubChem CID 71096886) has the molecular formula C12H24O9 and a molecular weight of 312.32 g/mol. Its IUPAC name is (2R,3R,4R,5R)-7-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]heptane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5R)-7-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]heptane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 71096886 |
| Molecular Formula | C12H24O9 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (2R,3R,4R,5R)-7-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]heptane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CC[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H24O9/c13-3-6(15)10(18)9(17)5(14)1-2-8-12(20)11(19)7(16)4-21-8/h5-20H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+/m1/s1 |
| InChIKey | LVPQDXZAIJNVAU-RBLWNENSSA-N |
| XLogP | -4.32 |
| TPSA | 171.07 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |