C45H34BClN4O3 — CID 174073046
9-[7-[4-[[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]methyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]dibenzofuran-3-yl]carbazole (PubChem CID 174073046) has the molecular formula C45H34BClN4O3 and a molecular weight of 725.06 g/mol. Its IUPAC name is 9-[7-[4-[[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]methyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]dibenzofuran-3-yl]carbazole.
| Compound Name | 9-[7-[4-[[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]methyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]dibenzofuran-3-yl]carbazole |
|---|---|
| PubChem CID | 174073046 |
| Molecular Formula | C45H34BClN4O3 |
| Molecular Weight | 725.06 g/mol |
| Exact Mass | 724.24 |
| IUPAC Name | 9-[7-[4-[[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]methyl]-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]dibenzofuran-3-yl]carbazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)oc2cc(-n4c5ccccc5c5ccccc54)ccc23)OC1(C)Cc1ccc(-c2nc(Cl)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C45H34BClN4O3/c1-44(2)45(3,27-28-17-19-30(20-18-28)42-48-41(49-43(47)50-42)29-11-5-4-6-12-29)54-46(53-44)31-21-23-35-36-24-22-32(26-40(36)52-39(35)25-31)51-37-15-9-7-13-33(37)34-14-8-10-16-38(34)51/h4-26H,27H2,1-3H3 |
| InChIKey | YPKYVUKNYGTXHB-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 75.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.06 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|