C15H13BN4O2 — CID 174081029
CID 174081029 (PubChem CID 174081029) has the molecular formula C15H13BN4O2 and a molecular weight of 292.11 g/mol.
| Compound Name | CID 174081029 |
|---|---|
| PubChem CID | 174081029 |
| Molecular Formula | C15H13BN4O2 |
| Molecular Weight | 292.11 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2ccc(C(=O)N3CC(C(N)=O)C3)nn2)cc1 |
| InChI | InChI=1S/C15H13BN4O2/c16-11-3-1-9(2-4-11)12-5-6-13(19-18-12)15(22)20-7-10(8-20)14(17)21/h1-6,10H,7-8H2,(H2,17,21) |
| InChIKey | YSZRSYFYVKGHDP-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.11 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|