C7H12BN3O3 — CID 174084477
CID 174084477 (PubChem CID 174084477) has the molecular formula C7H12BN3O3 and a molecular weight of 197.00 g/mol.
| Compound Name | CID 174084477 |
|---|---|
| PubChem CID | 174084477 |
| Molecular Formula | C7H12BN3O3 |
| Molecular Weight | 197.00 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | — |
| SMILES | [B]C1(O)CC(CC(N)C(N)=O)C(=O)N1 |
| InChI | InChI=1S/C7H12BN3O3/c8-7(14)2-3(6(13)11-7)1-4(9)5(10)12/h3-4,14H,1-2,9H2,(H2,10,12)(H,11,13) |
| InChIKey | RISNRQLIKZJQQQ-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.00 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|