C8H11BF6OS — CID 174085838
CID 174085838 (PubChem CID 174085838) has the molecular formula C8H11BF6OS and a molecular weight of 280.04 g/mol.
| Compound Name | CID 174085838 |
|---|---|
| PubChem CID | 174085838 |
| Molecular Formula | C8H11BF6OS |
| Molecular Weight | 280.04 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)OC(F)(F)C(F)(SCC)C(F)(F)F |
| InChI | InChI=1S/C8H11BF6OS/c1-4-17-6(10,7(11,12)13)8(14,15)16-5(2,3)9/h4H2,1-3H3 |
| InChIKey | WTBPBWIHGXBWRY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.04 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|