C17H15BClN2O3 — CID 174089295
CID 174089295 (PubChem CID 174089295) has the molecular formula C17H15BClN2O3 and a molecular weight of 341.58 g/mol.
| Compound Name | CID 174089295 |
|---|---|
| PubChem CID | 174089295 |
| Molecular Formula | C17H15BClN2O3 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C2=C([B]1)N=C1N(c3ccc(OCl)cc3)CC[C@@]1(O)C2=O |
| InChI | InChI=1S/C17H15BClN2O3/c1-9-10(2)18-15-13(9)14(22)17(23)7-8-21(16(17)20-15)11-3-5-12(24-19)6-4-11/h3-6,23H,7-8H2,1-2H3/t17-/m1/s1 |
| InChIKey | LBJAVKRPTAKGSG-QGZVFWFLSA-N |
| XLogP | 2.36 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|